C22H25N5O4 — CID 55697312
4-(2-nitrophenyl)-N-[3-(pyrrolidine-1-carbonyl)phenyl]piperazine-1-carboxamide (PubChem CID 55697312) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-(2-nitrophenyl)-N-[3-(pyrrolidine-1-carbonyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-nitrophenyl)-N-[3-(pyrrolidine-1-carbonyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55697312 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-(2-nitrophenyl)-N-[3-(pyrrolidine-1-carbonyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCCC2)c1)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H25N5O4/c28-21(25-10-3-4-11-25)17-6-5-7-18(16-17)23-22(29)26-14-12-24(13-15-26)19-8-1-2-9-20(19)27(30)31/h1-2,5-9,16H,3-4,10-15H2,(H,23,29) |
| InChIKey | JCQGUCGQDSDETF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|