C21H24N8O2 — CID 55697419
4-(2-anilino-2-oxoethyl)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]piperazine-1-carboxamide (PubChem CID 55697419) has the molecular formula C21H24N8O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is 4-(2-anilino-2-oxoethyl)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-anilino-2-oxoethyl)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55697419 |
| Molecular Formula | C21H24N8O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 4-(2-anilino-2-oxoethyl)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(CC(=O)Nc3ccccc3)CC2)cc1-n1cnnn1 |
| InChI | InChI=1S/C21H24N8O2/c1-16-7-8-18(13-19(16)29-15-22-25-26-29)24-21(31)28-11-9-27(10-12-28)14-20(30)23-17-5-3-2-4-6-17/h2-8,13,15H,9-12,14H2,1H3,(H,23,30)(H,24,31) |
| InChIKey | LQTBOJVVRQETKF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |