C23H24N4O3 — CID 55698533
1-[(3-methoxyphenyl)methyl]-1-methyl-3-[3-(phenylcarbamoylamino)phenyl]urea (PubChem CID 55698533) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-1-methyl-3-[3-(phenylcarbamoylamino)phenyl]urea.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-1-methyl-3-[3-(phenylcarbamoylamino)phenyl]urea |
|---|---|
| PubChem CID | 55698533 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-1-methyl-3-[3-(phenylcarbamoylamino)phenyl]urea |
| SMILES | COc1cccc(CN(C)C(=O)Nc2cccc(NC(=O)Nc3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H24N4O3/c1-27(16-17-8-6-13-21(14-17)30-2)23(29)26-20-12-7-11-19(15-20)25-22(28)24-18-9-4-3-5-10-18/h3-15H,16H2,1-2H3,(H,26,29)(H2,24,25,28) |
| InChIKey | VPXZOZRJQBOZHH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |