C15H15BrN6OS — CID 55698907
1-[(5-bromothiophen-2-yl)methyl]-1-methyl-3-[3-(1-methyltetrazol-5-yl)phenyl]urea (PubChem CID 55698907) has the molecular formula C15H15BrN6OS and a molecular weight of 407.30 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-1-methyl-3-[3-(1-methyltetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-1-methyl-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 55698907 |
| Molecular Formula | C15H15BrN6OS |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-1-methyl-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)Nc1cccc(-c2nnnn2C)c1 |
| InChI | InChI=1S/C15H15BrN6OS/c1-21(9-12-6-7-13(16)24-12)15(23)17-11-5-3-4-10(8-11)14-18-19-20-22(14)2/h3-8H,9H2,1-2H3,(H,17,23) |
| InChIKey | JJOZTJZVAJBRNT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |