C18H25N5O7S2 — CID 55699112
4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[4-[methoxy(methyl)sulfamoyl]phenyl]piperazine-1-carboxamide (PubChem CID 55699112) has the molecular formula C18H25N5O7S2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[4-[methoxy(methyl)sulfamoyl]phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[4-[methoxy(methyl)sulfamoyl]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55699112 |
| Molecular Formula | C18H25N5O7S2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[4-[methoxy(methyl)sulfamoyl]phenyl]piperazine-1-carboxamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(NC(=O)N2CCN(S(=O)(=O)c3c(C)noc3C)CC2)cc1 |
| InChI | InChI=1S/C18H25N5O7S2/c1-13-17(14(2)30-20-13)32(27,28)23-11-9-22(10-12-23)18(24)19-15-5-7-16(8-6-15)31(25,26)21(3)29-4/h5-8H,9-12H2,1-4H3,(H,19,24) |
| InChIKey | FCDAXBVRBKAXQW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|