C28H27FN2O3 — CID 55699882
N-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-(2-methoxyphenyl)-2-phenylprop-2-enamide (PubChem CID 55699882) has the molecular formula C28H27FN2O3 and a molecular weight of 458.53 g/mol. Its IUPAC name is N-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-(2-methoxyphenyl)-2-phenylprop-2-enamide.
| Compound Name | N-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-(2-methoxyphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 55699882 |
| Molecular Formula | C28H27FN2O3 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-(2-methoxyphenyl)-2-phenylprop-2-enamide |
| SMILES | COc1ccccc1C=C(C(=O)NC1CCN(C(=O)c2ccccc2F)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H27FN2O3/c1-34-26-14-8-5-11-21(26)19-24(20-9-3-2-4-10-20)27(32)30-22-15-17-31(18-16-22)28(33)23-12-6-7-13-25(23)29/h2-14,19,22H,15-18H2,1H3,(H,30,32) |
| InChIKey | ZJENKEVRABUAEZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|