C15H18F3N5O2 — CID 55700093
2-methyl-N-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine (PubChem CID 55700093) has the molecular formula C15H18F3N5O2 and a molecular weight of 357.34 g/mol. Its IUPAC name is 2-methyl-N-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine.
| Compound Name | 2-methyl-N-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 55700093 |
| Molecular Formula | C15H18F3N5O2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-methyl-N-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine |
| SMILES | CC(C)CN(Cn1cnc(-c2ccc([N+](=O)[O-])cc2)n1)CC(F)(F)F |
| InChI | InChI=1S/C15H18F3N5O2/c1-11(2)7-21(8-15(16,17)18)10-22-9-19-14(20-22)12-3-5-13(6-4-12)23(24)25/h3-6,9,11H,7-8,10H2,1-2H3 |
| InChIKey | CJKJXNWZJYMBIP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|