C14H13Cl3N4O5S — CID 55701304
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-[(1-methylpyrazol-4-yl)sulfonylamino]acetate (PubChem CID 55701304) has the molecular formula C14H13Cl3N4O5S and a molecular weight of 455.71 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-[(1-methylpyrazol-4-yl)sulfonylamino]acetate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-[(1-methylpyrazol-4-yl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 55701304 |
| Molecular Formula | C14H13Cl3N4O5S |
| Molecular Weight | 455.71 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-[(1-methylpyrazol-4-yl)sulfonylamino]acetate |
| SMILES | Cn1cc(S(=O)(=O)NCC(=O)OCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C14H13Cl3N4O5S/c1-21-6-8(4-18-21)27(24,25)19-5-14(23)26-7-13(22)20-12-3-10(16)9(15)2-11(12)17/h2-4,6,19H,5,7H2,1H3,(H,20,22) |
| InChIKey | GVDJVYOHVYAHRK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.71 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|