About (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate
(2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate (PubChem CID 55701341) has the molecular formula C12H16N2O4S
and a molecular weight of 284.34 g/mol. Its IUPAC name is (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate |
| PubChem CID | 55701341 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate |
| SMILES | CC(=O)Nc1nc(COC(=O)C2(O)CCCC2)cs1 |
| InChI | InChI=1S/C12H16N2O4S/c1-8(15)13-11-14-9(7-19-11)6-18-10(16)12(17)4-2-3-5-12/h7,17H,2-6H2,1H3,(H,13,14,15) |
| InChIKey | XMTPQMINULDRQN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate?
The IUPAC name of (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate (CID 55701341) is (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate.
What is the SMILES notation for (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate?
The canonical SMILES for (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate is CC(=O)Nc1nc(COC(=O)C2(O)CCCC2)cs1.
What is the InChIKey of (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate?
The InChIKey is XMTPQMINULDRQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4S/c1-8(15)13-11-14-9(7-19-11)6-18-10(16)12(17)4-2-3-5-12/h7,17H,2-6H2,1H3,(H,13,14,15).
What are the key properties of (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate?
(2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate has a molecular weight of 284.34 g/mol, XLogP of 1.45, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamido-1,3-thiazol-4-yl)methyl 1-hydroxycyclopentane-1-carboxylate is sourced from PubChem (CID 55701341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).