C15H19BrF3N3O3 — CID 55701940
1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea (PubChem CID 55701940) has the molecular formula C15H19BrF3N3O3 and a molecular weight of 426.23 g/mol. Its IUPAC name is 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea.
| Compound Name | 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
|---|---|
| PubChem CID | 55701940 |
| Molecular Formula | C15H19BrF3N3O3 |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
| SMILES | CN(CCCNC(=O)Nc1cc2c(cc1Br)OCCO2)CC(F)(F)F |
| InChI | InChI=1S/C15H19BrF3N3O3/c1-22(9-15(17,18)19)4-2-3-20-14(23)21-11-8-13-12(7-10(11)16)24-5-6-25-13/h7-8H,2-6,9H2,1H3,(H2,20,21,23) |
| InChIKey | GNGCLOSPSWWKQU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|