C21H25ClN2O5S — CID 55704533
3-(4-chlorophenoxy)-1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 55704533) has the molecular formula C21H25ClN2O5S and a molecular weight of 452.96 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 3-(4-chlorophenoxy)-1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 55704533 |
| Molecular Formula | C21H25ClN2O5S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 3-(4-chlorophenoxy)-1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)CCOc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H25ClN2O5S/c1-2-28-18-7-9-20(10-8-18)30(26,27)24-14-12-23(13-15-24)21(25)11-16-29-19-5-3-17(22)4-6-19/h3-10H,2,11-16H2,1H3 |
| InChIKey | WVDDGXWEMJOZOX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |