About 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide
2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide (PubChem CID 55705341) has the molecular formula C19H20ClN5O2S
and a molecular weight of 417.92 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide |
| PubChem CID | 55705341 |
| Molecular Formula | C19H20ClN5O2S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide |
| SMILES | O=C(CC1Sc2ccc(Cl)cc2NC1=O)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H20ClN5O2S/c20-12-2-3-15-14(10-12)24-18(27)16(28-15)11-17(26)23-13-4-8-25(9-5-13)19-21-6-1-7-22-19/h1-3,6-7,10,13,16H,4-5,8-9,11H2,(H,23,26)(H,24,27) |
| InChIKey | XTNCEXKAAGJKCN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide?
The IUPAC name of 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide (CID 55705341) is 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide.
What is the SMILES notation for 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide?
The canonical SMILES for 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide is O=C(CC1Sc2ccc(Cl)cc2NC1=O)NC1CCN(c2ncccn2)CC1.
What is the InChIKey of 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide?
The InChIKey is XTNCEXKAAGJKCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClN5O2S/c20-12-2-3-15-14(10-12)24-18(27)16(28-15)11-17(26)23-13-4-8-25(9-5-13)19-21-6-1-7-22-19/h1-3,6-7,10,13,16H,4-5,8-9,11H2,(H,23,26)(H,24,27).
What are the key properties of 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide?
2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide has a molecular weight of 417.92 g/mol, XLogP of 2.72, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide is sourced from PubChem (CID 55705341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).