C24H21F2NO2 — CID 55706094
(E)-3-(2,6-difluorophenyl)-N-[[2-(phenylmethoxymethyl)phenyl]methyl]prop-2-enamide (PubChem CID 55706094) has the molecular formula C24H21F2NO2 and a molecular weight of 393.43 g/mol. Its IUPAC name is (E)-3-(2,6-difluorophenyl)-N-[[2-(phenylmethoxymethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-difluorophenyl)-N-[[2-(phenylmethoxymethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55706094 |
| Molecular Formula | C24H21F2NO2 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (E)-3-(2,6-difluorophenyl)-N-[[2-(phenylmethoxymethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1c(F)cccc1F)NCc1ccccc1COCc1ccccc1 |
| InChI | InChI=1S/C24H21F2NO2/c25-22-11-6-12-23(26)21(22)13-14-24(28)27-15-19-9-4-5-10-20(19)17-29-16-18-7-2-1-3-8-18/h1-14H,15-17H2,(H,27,28)/b14-13+ |
| InChIKey | MHJCYXPLKRPSEY-BUHFOSPRSA-N |
| XLogP | 5.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|