C22H20BrN3O3 — CID 55706261
N-[3-[[acetyl(methyl)amino]methyl]phenyl]-6-(3-bromophenoxy)pyridine-3-carboxamide (PubChem CID 55706261) has the molecular formula C22H20BrN3O3 and a molecular weight of 454.32 g/mol. Its IUPAC name is N-[3-[[acetyl(methyl)amino]methyl]phenyl]-6-(3-bromophenoxy)pyridine-3-carboxamide.
| Compound Name | N-[3-[[acetyl(methyl)amino]methyl]phenyl]-6-(3-bromophenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55706261 |
| Molecular Formula | C22H20BrN3O3 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[3-[[acetyl(methyl)amino]methyl]phenyl]-6-(3-bromophenoxy)pyridine-3-carboxamide |
| SMILES | CC(=O)N(C)Cc1cccc(NC(=O)c2ccc(Oc3cccc(Br)c3)nc2)c1 |
| InChI | InChI=1S/C22H20BrN3O3/c1-15(27)26(2)14-16-5-3-7-19(11-16)25-22(28)17-9-10-21(24-13-17)29-20-8-4-6-18(23)12-20/h3-13H,14H2,1-2H3,(H,25,28) |
| InChIKey | BQYVSUCGCBJUEM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |