C21H18ClFN2O4 — CID 55707775
N-[5-[2-(3-chlorophenoxy)propanoylamino]-2-fluorophenyl]-2-methylfuran-3-carboxamide (PubChem CID 55707775) has the molecular formula C21H18ClFN2O4 and a molecular weight of 416.84 g/mol. Its IUPAC name is N-[5-[2-(3-chlorophenoxy)propanoylamino]-2-fluorophenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[5-[2-(3-chlorophenoxy)propanoylamino]-2-fluorophenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 55707775 |
| Molecular Formula | C21H18ClFN2O4 |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N-[5-[2-(3-chlorophenoxy)propanoylamino]-2-fluorophenyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)Nc1cc(NC(=O)C(C)Oc2cccc(Cl)c2)ccc1F |
| InChI | InChI=1S/C21H18ClFN2O4/c1-12-17(8-9-28-12)21(27)25-19-11-15(6-7-18(19)23)24-20(26)13(2)29-16-5-3-4-14(22)10-16/h3-11,13H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | CXDQRBFNUXYEOX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |