C23H21N3O3 — CID 55707900
2-(4-cyanophenoxy)-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]propanamide (PubChem CID 55707900) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]propanamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55707900 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]propanamide |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)NCc1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C23H21N3O3/c1-17(29-22-10-4-18(13-24)5-11-22)23(27)26-15-19-6-8-21(9-7-19)28-16-20-3-2-12-25-14-20/h2-12,14,17H,15-16H2,1H3,(H,26,27) |
| InChIKey | FJMCEYAZBBJVMQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |