1-methylcyclopent-2-ene-1-carboxylic acid

C7H10O2 — CID 557084

IUPAC1-methylcyclopent-2-ene-1-carboxylic acid
SMILESCC1(C(=O)O)C=CCC1
InChIInChI=1S/C7H10O2/c1-7(6(8)9)4-2-3-5-7/h2,4H,3,5H2,1H3,(H,8,9)
InChIKeyHGSACGMRDLYHMZ-UHFFFAOYSA-N
MW126.15 g/mol
LogP1.43
Rot. Bonds1

About 1-methylcyclopent-2-ene-1-carboxylic acid

1-methylcyclopent-2-ene-1-carboxylic acid (PubChem CID 557084) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is 1-methylcyclopent-2-ene-1-carboxylic acid.

Molecular Properties

Compound Name1-methylcyclopent-2-ene-1-carboxylic acid
PubChem CID557084
Molecular FormulaC7H10O2
Molecular Weight126.15 g/mol
Exact Mass126.07
IUPAC Name1-methylcyclopent-2-ene-1-carboxylic acid
SMILESCC1(C(=O)O)C=CCC1
InChIInChI=1S/C7H10O2/c1-7(6(8)9)4-2-3-5-7/h2,4H,3,5H2,1H3,(H,8,9)
InChIKeyHGSACGMRDLYHMZ-UHFFFAOYSA-N
XLogP1.43
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.15
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 1-methylcyclopent-2-ene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methylcyclopent-2-ene-1-carboxylic acid?
The IUPAC name of 1-methylcyclopent-2-ene-1-carboxylic acid (CID 557084) is 1-methylcyclopent-2-ene-1-carboxylic acid.
What is the SMILES notation for 1-methylcyclopent-2-ene-1-carboxylic acid?
The canonical SMILES for 1-methylcyclopent-2-ene-1-carboxylic acid is CC1(C(=O)O)C=CCC1.
What is the InChIKey of 1-methylcyclopent-2-ene-1-carboxylic acid?
The InChIKey is HGSACGMRDLYHMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-7(6(8)9)4-2-3-5-7/h2,4H,3,5H2,1H3,(H,8,9).
What are the key properties of 1-methylcyclopent-2-ene-1-carboxylic acid?
1-methylcyclopent-2-ene-1-carboxylic acid has a molecular weight of 126.15 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclopent-2-ene-1-carboxylic acid is sourced from PubChem (CID 557084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).