About 1,3-dichlorocyclohexane
1,3-dichlorocyclohexane (PubChem CID 557105) has the molecular formula C6H10Cl2
and a molecular weight of 153.05 g/mol. Its IUPAC name is 1,3-dichlorocyclohexane.
Molecular Properties
| Compound Name | 1,3-dichlorocyclohexane |
| PubChem CID | 557105 |
| Molecular Formula | C6H10Cl2 |
| Molecular Weight | 153.05 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 1,3-dichlorocyclohexane |
| SMILES | ClC1CCCC(Cl)C1 |
| InChI | InChI=1S/C6H10Cl2/c7-5-2-1-3-6(8)4-5/h5-6H,1-4H2 |
| InChIKey | HXWLCXAXTOJPJL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.05 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichlorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichlorocyclohexane?
The IUPAC name of 1,3-dichlorocyclohexane (CID 557105) is 1,3-dichlorocyclohexane.
What is the SMILES notation for 1,3-dichlorocyclohexane?
The canonical SMILES for 1,3-dichlorocyclohexane is ClC1CCCC(Cl)C1.
What is the InChIKey of 1,3-dichlorocyclohexane?
The InChIKey is HXWLCXAXTOJPJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl2/c7-5-2-1-3-6(8)4-5/h5-6H,1-4H2.
What are the key properties of 1,3-dichlorocyclohexane?
1,3-dichlorocyclohexane has a molecular weight of 153.05 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichlorocyclohexane is sourced from PubChem (CID 557105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).