C22H25FN4O3 — CID 55710997
N-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-(phenylcarbamoylamino)propanamide (PubChem CID 55710997) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-(phenylcarbamoylamino)propanamide.
| Compound Name | N-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-(phenylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 55710997 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-(phenylcarbamoylamino)propanamide |
| SMILES | CC(NC(=O)Nc1ccccc1)C(=O)NC1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H25FN4O3/c1-15(24-22(30)26-16-7-3-2-4-8-16)20(28)25-17-11-13-27(14-12-17)21(29)18-9-5-6-10-19(18)23/h2-10,15,17H,11-14H2,1H3,(H,25,28)(H2,24,26,30) |
| InChIKey | QOXHVKFFAZNYBC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |