About 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide
3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide (PubChem CID 55712850) has the molecular formula C17H26BrF3N2O
and a molecular weight of 411.31 g/mol. Its IUPAC name is 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide |
| PubChem CID | 55712850 |
| Molecular Formula | C17H26BrF3N2O |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide |
| SMILES | CN(CCCNC(=O)C12CC3CC(CC(Br)(C3)C1)C2)CC(F)(F)F |
| InChI | InChI=1S/C17H26BrF3N2O/c1-23(11-17(19,20)21)4-2-3-22-14(24)15-6-12-5-13(7-15)9-16(18,8-12)10-15/h12-13H,2-11H2,1H3,(H,22,24) |
| InChIKey | AHSJXWMNXHBQEH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide?
The IUPAC name of 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide (CID 55712850) is 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide.
What is the SMILES notation for 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide?
The canonical SMILES for 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide is CN(CCCNC(=O)C12CC3CC(CC(Br)(C3)C1)C2)CC(F)(F)F.
What is the InChIKey of 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide?
The InChIKey is AHSJXWMNXHBQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26BrF3N2O/c1-23(11-17(19,20)21)4-2-3-22-14(24)15-6-12-5-13(7-15)9-16(18,8-12)10-15/h12-13H,2-11H2,1H3,(H,22,24).
What are the key properties of 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide?
3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide has a molecular weight of 411.31 g/mol, XLogP of 3.72, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]adamantane-1-carboxamide is sourced from PubChem (CID 55712850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).