C13H16BrF3N2OS — CID 55713153
(E)-3-(5-bromothiophen-2-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide (PubChem CID 55713153) has the molecular formula C13H16BrF3N2OS and a molecular weight of 385.25 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 55713153 |
| Molecular Formula | C13H16BrF3N2OS |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide |
| SMILES | CN(CCCNC(=O)/C=C/c1ccc(Br)s1)CC(F)(F)F |
| InChI | InChI=1S/C13H16BrF3N2OS/c1-19(9-13(15,16)17)8-2-7-18-12(20)6-4-10-3-5-11(14)21-10/h3-6H,2,7-9H2,1H3,(H,18,20)/b6-4+ |
| InChIKey | QRLZJWXFMDMOFQ-GQCTYLIASA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|