C18H24N2O6 — CID 55714302
3-(2,5-dioxopyrrolidin-1-yl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]propanamide (PubChem CID 55714302) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 55714302 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1cc(C(C)NC(=O)CCN2C(=O)CCC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H24N2O6/c1-11(12-9-13(24-2)18(26-4)14(10-12)25-3)19-15(21)7-8-20-16(22)5-6-17(20)23/h9-11H,5-8H2,1-4H3,(H,19,21) |
| InChIKey | JWQLIXCPAUQUCP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|