C19H20IN3O — CID 55717328
N-[(4-cyanophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-iodobenzamide (PubChem CID 55717328) has the molecular formula C19H20IN3O and a molecular weight of 433.29 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-iodobenzamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 55717328 |
| Molecular Formula | C19H20IN3O |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-iodobenzamide |
| SMILES | CN(C)CCN(Cc1ccc(C#N)cc1)C(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C19H20IN3O/c1-22(2)10-11-23(14-16-8-6-15(13-21)7-9-16)19(24)17-4-3-5-18(20)12-17/h3-9,12H,10-11,14H2,1-2H3 |
| InChIKey | HUNFHKHCSXWQER-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|