C28H27N3O4 — CID 55718668
1-(3,5-dimethoxybenzoyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]piperidine-4-carboxamide (PubChem CID 55718668) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 1-(3,5-dimethoxybenzoyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(3,5-dimethoxybenzoyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55718668 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 1-(3,5-dimethoxybenzoyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]piperidine-4-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(C(=O)Nc3cccc(C#Cc4ccccn4)c3)CC2)c1 |
| InChI | InChI=1S/C28H27N3O4/c1-34-25-17-22(18-26(19-25)35-2)28(33)31-14-11-21(12-15-31)27(32)30-24-8-5-6-20(16-24)9-10-23-7-3-4-13-29-23/h3-8,13,16-19,21H,11-12,14-15H2,1-2H3,(H,30,32) |
| InChIKey | KLJYOPVGAHUBJK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|