C24H30N2O6 — CID 55718683
2-methoxyethyl 5-[4-(4-methoxybenzoyl)piperidine-1-carbonyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 55718683) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-methoxyethyl 5-[4-(4-methoxybenzoyl)piperidine-1-carbonyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | 2-methoxyethyl 5-[4-(4-methoxybenzoyl)piperidine-1-carbonyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55718683 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-methoxyethyl 5-[4-(4-methoxybenzoyl)piperidine-1-carbonyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)[nH]c(C(=O)N2CCC(C(=O)c3ccc(OC)cc3)CC2)c1C |
| InChI | InChI=1S/C24H30N2O6/c1-15-20(24(29)32-14-13-30-3)16(2)25-21(15)23(28)26-11-9-18(10-12-26)22(27)17-5-7-19(31-4)8-6-17/h5-8,18,25H,9-14H2,1-4H3 |
| InChIKey | YBYDVGMFRPQQDV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|