C20H21F3N4O2 — CID 55720293
3-(furan-2-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-phenylpyrazole-5-carboxamide (PubChem CID 55720293) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-phenylpyrazole-5-carboxamide.
| Compound Name | 3-(furan-2-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 55720293 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-(furan-2-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-phenylpyrazole-5-carboxamide |
| SMILES | CN(CCCNC(=O)c1cc(-c2ccco2)nn1-c1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C20H21F3N4O2/c1-26(14-20(21,22)23)11-6-10-24-19(28)17-13-16(18-9-5-12-29-18)25-27(17)15-7-3-2-4-8-15/h2-5,7-9,12-13H,6,10-11,14H2,1H3,(H,24,28) |
| InChIKey | XHHPOYKUZLLJJC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|