C20H26F3N3O — CID 55720593
6-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 55720593) has the molecular formula C20H26F3N3O and a molecular weight of 381.44 g/mol. Its IUPAC name is 6-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | 6-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 55720593 |
| Molecular Formula | C20H26F3N3O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 6-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | CC1CCc2[nH]c3c(C(=O)NCCCN(C)CC(F)(F)F)cccc3c2C1 |
| InChI | InChI=1S/C20H26F3N3O/c1-13-7-8-17-16(11-13)14-5-3-6-15(18(14)25-17)19(27)24-9-4-10-26(2)12-20(21,22)23/h3,5-6,13,25H,4,7-12H2,1-2H3,(H,24,27) |
| InChIKey | NHKXNOHISQEFJU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|