C14H17NO2 — CID 557216
N-(furan-2-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 557216) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 557216 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-(furan-2-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | O=C(NCc1ccco1)C1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C14H17NO2/c16-14(15-7-10-2-1-5-17-10)13-11-8-3-4-9(6-8)12(11)13/h1-2,5,8-9,11-13H,3-4,6-7H2,(H,15,16) |
| InChIKey | DOHVNPVMJWEUJI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |