C19H21N5O2S — CID 55721707
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide (PubChem CID 55721707) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 55721707 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide |
| SMILES | Cc1noc(C)c1CSc1ccccc1C(=O)NCCNc1ncccn1 |
| InChI | InChI=1S/C19H21N5O2S/c1-13-16(14(2)26-24-13)12-27-17-7-4-3-6-15(17)18(25)20-10-11-23-19-21-8-5-9-22-19/h3-9H,10-12H2,1-2H3,(H,20,25)(H,21,22,23) |
| InChIKey | CPVIPGAYYGCYPU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|