About furan-2-ylmethyl heptanoate
furan-2-ylmethyl heptanoate (PubChem CID 557223) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is furan-2-ylmethyl heptanoate.
Molecular Properties
| Compound Name | furan-2-ylmethyl heptanoate |
| PubChem CID | 557223 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | furan-2-ylmethyl heptanoate |
| SMILES | CCCCCCC(=O)OCc1ccco1 |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-5-8-12(13)15-10-11-7-6-9-14-11/h6-7,9H,2-5,8,10H2,1H3 |
| InChIKey | VZRGLBPRLIGTPE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze furan-2-ylmethyl heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl heptanoate?
The IUPAC name of furan-2-ylmethyl heptanoate (CID 557223) is furan-2-ylmethyl heptanoate.
What is the SMILES notation for furan-2-ylmethyl heptanoate?
The canonical SMILES for furan-2-ylmethyl heptanoate is CCCCCCC(=O)OCc1ccco1.
What is the InChIKey of furan-2-ylmethyl heptanoate?
The InChIKey is VZRGLBPRLIGTPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-2-3-4-5-8-12(13)15-10-11-7-6-9-14-11/h6-7,9H,2-5,8,10H2,1H3.
What are the key properties of furan-2-ylmethyl heptanoate?
furan-2-ylmethyl heptanoate has a molecular weight of 210.27 g/mol, XLogP of 3.29, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl heptanoate is sourced from PubChem (CID 557223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).