C20H22Cl2N4O4 — CID 55723051
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55723051) has the molecular formula C20H22Cl2N4O4 and a molecular weight of 453.33 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55723051 |
| Molecular Formula | C20H22Cl2N4O4 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2CC(C(=O)NCCNc3ncc(Cl)cc3Cl)CC2=O)cc1OC |
| InChI | InChI=1S/C20H22Cl2N4O4/c1-29-16-4-3-14(9-17(16)30-2)26-11-12(7-18(26)27)20(28)24-6-5-23-19-15(22)8-13(21)10-25-19/h3-4,8-10,12H,5-7,11H2,1-2H3,(H,23,25)(H,24,28) |
| InChIKey | ZOXKGFXDRYOGAV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|