C22H28N4O2 — CID 55724574
N-(4-methoxybutyl)-6-(2-methylphenyl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55724574) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-(4-methoxybutyl)-6-(2-methylphenyl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(4-methoxybutyl)-6-(2-methylphenyl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55724574 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-(4-methoxybutyl)-6-(2-methylphenyl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | COCCCCNC(=O)c1cc(-c2ccccc2C)nc2c1cnn2C(C)C |
| InChI | InChI=1S/C22H28N4O2/c1-15(2)26-21-19(14-24-26)18(22(27)23-11-7-8-12-28-4)13-20(25-21)17-10-6-5-9-16(17)3/h5-6,9-10,13-15H,7-8,11-12H2,1-4H3,(H,23,27) |
| InChIKey | AUZQWEKLQXLLCM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|