C21H26N4O4 — CID 55724733
1-[(2,4-dimethoxyphenyl)methyl]-N-(4-methoxybutyl)pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 55724733) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-N-(4-methoxybutyl)pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-N-(4-methoxybutyl)pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 55724733 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-N-(4-methoxybutyl)pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | COCCCCNC(=O)c1cnc2c(cnn2Cc2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C21H26N4O4/c1-27-9-5-4-8-22-21(26)17-10-16-13-24-25(20(16)23-12-17)14-15-6-7-18(28-2)11-19(15)29-3/h6-7,10-13H,4-5,8-9,14H2,1-3H3,(H,22,26) |
| InChIKey | ADKJRHBOMVSGFS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|