About N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide
N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 55724914) has the molecular formula C23H32N2O3
and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide |
| PubChem CID | 55724914 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | Cc1cccc(C)c1OCCNC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H32N2O3/c1-15-4-3-5-16(2)21(15)28-7-6-24-20(26)14-25-22(27)23-11-17-8-18(12-23)10-19(9-17)13-23/h3-5,17-19H,6-14H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | PSBWBKPFTSAYNE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide?
The IUPAC name of N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide (CID 55724914) is N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide.
What is the SMILES notation for N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide?
The canonical SMILES for N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide is Cc1cccc(C)c1OCCNC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide?
The InChIKey is PSBWBKPFTSAYNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N2O3/c1-15-4-3-5-16(2)21(15)28-7-6-24-20(26)14-25-22(27)23-11-17-8-18(12-23)10-19(9-17)13-23/h3-5,17-19H,6-14H2,1-2H3,(H,24,26)(H,25,27).
What are the key properties of N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide?
N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide has a molecular weight of 384.52 g/mol, XLogP of 3.13, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]adamantane-1-carboxamide is sourced from PubChem (CID 55724914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).