C23H25N3O3S — CID 55726000
N-[2-(N-methylanilino)phenyl]-2-(2-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 55726000) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[2-(N-methylanilino)phenyl]-2-(2-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[2-(N-methylanilino)phenyl]-2-(2-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 55726000 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[2-(N-methylanilino)phenyl]-2-(2-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1ccccc1N(CC(=O)Nc1ccccc1N(C)c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H25N3O3S/c1-18-11-7-9-15-21(18)26(30(3,28)29)17-23(27)24-20-14-8-10-16-22(20)25(2)19-12-5-4-6-13-19/h4-16H,17H2,1-3H3,(H,24,27) |
| InChIKey | DSQFTODTODKXRG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |