C24H18ClFN2O2S — CID 55727295
2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]acetamide (PubChem CID 55727295) has the molecular formula C24H18ClFN2O2S and a molecular weight of 452.94 g/mol. Its IUPAC name is 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]acetamide.
| Compound Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55727295 |
| Molecular Formula | C24H18ClFN2O2S |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]acetamide |
| SMILES | CC(=O)c1ccc(SCC(=O)Nc2ccc(C(C#N)c3ccccc3)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C24H18ClFN2O2S/c1-15(29)17-7-10-23(22(26)11-17)31-14-24(30)28-18-8-9-19(21(25)12-18)20(13-27)16-5-3-2-4-6-16/h2-12,20H,14H2,1H3,(H,28,30) |
| InChIKey | ZJBXZJPBKQYRJK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |