C19H22ClN3O3S — CID 55727397
N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 55727397) has the molecular formula C19H22ClN3O3S and a molecular weight of 407.92 g/mol. Its IUPAC name is N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 55727397 |
| Molecular Formula | C19H22ClN3O3S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC12CCC(=O)N1C(C(=O)Nc1cc(Cl)ccc1C(=O)N1CCCC1)CS2 |
| InChI | InChI=1S/C19H22ClN3O3S/c1-19-7-6-16(24)23(19)15(11-27-19)17(25)21-14-10-12(20)4-5-13(14)18(26)22-8-2-3-9-22/h4-5,10,15H,2-3,6-9,11H2,1H3,(H,21,25) |
| InChIKey | PQUZRAPLWNIVMV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |