About bicyclo[3.3.1]nonan-9-ol
bicyclo[3.3.1]nonan-9-ol (PubChem CID 557281) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is bicyclo[3.3.1]nonan-9-ol.
Molecular Properties
| Compound Name | bicyclo[3.3.1]nonan-9-ol |
| PubChem CID | 557281 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | bicyclo[3.3.1]nonan-9-ol |
| SMILES | OC1C2CCCC1CCC2 |
| InChI | InChI=1S/C9H16O/c10-9-7-3-1-4-8(9)6-2-5-7/h7-10H,1-6H2 |
| InChIKey | FCEAXXVYZXAQHQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[3.3.1]nonan-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.3.1]nonan-9-ol?
The IUPAC name of bicyclo[3.3.1]nonan-9-ol (CID 557281) is bicyclo[3.3.1]nonan-9-ol.
What is the SMILES notation for bicyclo[3.3.1]nonan-9-ol?
The canonical SMILES for bicyclo[3.3.1]nonan-9-ol is OC1C2CCCC1CCC2.
What is the InChIKey of bicyclo[3.3.1]nonan-9-ol?
The InChIKey is FCEAXXVYZXAQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c10-9-7-3-1-4-8(9)6-2-5-7/h7-10H,1-6H2.
What are the key properties of bicyclo[3.3.1]nonan-9-ol?
bicyclo[3.3.1]nonan-9-ol has a molecular weight of 140.23 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.3.1]nonan-9-ol is sourced from PubChem (CID 557281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).