C21H19FN4O3S — CID 55728330
(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 55728330) has the molecular formula C21H19FN4O3S and a molecular weight of 426.47 g/mol. Its IUPAC name is (2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 55728330 |
| Molecular Formula | C21H19FN4O3S |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(C1=CN2CCS(=O)(=O)N=C2C=C1)N1CC=C(c2c[nH]c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C21H19FN4O3S/c22-16-2-3-17-18(12-23-19(17)11-16)14-5-7-25(8-6-14)21(27)15-1-4-20-24-30(28,29)10-9-26(20)13-15/h1-5,11-13,23H,6-10H2 |
| InChIKey | FOFIJZAAWJDPBC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |