C25H24FNO6 — CID 55728816
(7,8-dimethyl-2-oxochromen-4-yl)methyl 1-[2-(2-fluorophenyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 55728816) has the molecular formula C25H24FNO6 and a molecular weight of 453.47 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 1-[2-(2-fluorophenyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 1-[2-(2-fluorophenyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55728816 |
| Molecular Formula | C25H24FNO6 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 1-[2-(2-fluorophenyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)C3CC(O)CN3C(=O)Cc3ccccc3F)cc(=O)oc2c1C |
| InChI | InChI=1S/C25H24FNO6/c1-14-7-8-19-17(10-23(30)33-24(19)15(14)2)13-32-25(31)21-11-18(28)12-27(21)22(29)9-16-5-3-4-6-20(16)26/h3-8,10,18,21,28H,9,11-13H2,1-2H3 |
| InChIKey | BPZSZWNBDGGYBE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|