C22H18ClN3O6 — CID 55730036
[5-ethoxycarbonyl-4-(furan-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidin-6-yl]methyl 2-chloroquinoline-6-carboxylate (PubChem CID 55730036) has the molecular formula C22H18ClN3O6 and a molecular weight of 455.85 g/mol. Its IUPAC name is [5-ethoxycarbonyl-4-(furan-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidin-6-yl]methyl 2-chloroquinoline-6-carboxylate.
| Compound Name | [5-ethoxycarbonyl-4-(furan-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidin-6-yl]methyl 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55730036 |
| Molecular Formula | C22H18ClN3O6 |
| Molecular Weight | 455.85 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | [5-ethoxycarbonyl-4-(furan-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidin-6-yl]methyl 2-chloroquinoline-6-carboxylate |
| SMILES | CCOC(=O)C1=C(COC(=O)c2ccc3nc(Cl)ccc3c2)NC(=O)NC1c1ccco1 |
| InChI | InChI=1S/C22H18ClN3O6/c1-2-30-21(28)18-15(25-22(29)26-19(18)16-4-3-9-31-16)11-32-20(27)13-5-7-14-12(10-13)6-8-17(23)24-14/h3-10,19H,2,11H2,1H3,(H2,25,26,29) |
| InChIKey | CXDHJYHXSBITMV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.85 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|