About dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane
dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane (PubChem CID 557323) has the molecular formula C10H17Cl2P
and a molecular weight of 239.13 g/mol. Its IUPAC name is dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane.
Molecular Properties
| Compound Name | dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane |
| PubChem CID | 557323 |
| Molecular Formula | C10H17Cl2P |
| Molecular Weight | 239.13 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane |
| SMILES | CC1(C)C2CCC1(C)C(P(Cl)Cl)C2 |
| InChI | InChI=1S/C10H17Cl2P/c1-9(2)7-4-5-10(9,3)8(6-7)13(11)12/h7-8H,4-6H2,1-3H3 |
| InChIKey | NWSKJHMGMCBQAM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.13 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane?
The IUPAC name of dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane (CID 557323) is dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane.
What is the SMILES notation for dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane?
The canonical SMILES for dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane is CC1(C)C2CCC1(C)C(P(Cl)Cl)C2.
What is the InChIKey of dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane?
The InChIKey is NWSKJHMGMCBQAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Cl2P/c1-9(2)7-4-5-10(9,3)8(6-7)13(11)12/h7-8H,4-6H2,1-3H3.
What are the key properties of dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane?
dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane has a molecular weight of 239.13 g/mol, XLogP of 4.99, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane is sourced from PubChem (CID 557323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).