C22H22N6O2S — CID 55732336
4-methyl-2-oxo-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 55732336) has the molecular formula C22H22N6O2S and a molecular weight of 434.53 g/mol. Its IUPAC name is 4-methyl-2-oxo-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | 4-methyl-2-oxo-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 55732336 |
| Molecular Formula | C22H22N6O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 4-methyl-2-oxo-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccc(-n3cncn3)cc2)sc2nc3n(c(=O)c12)CCCCC3 |
| InChI | InChI=1S/C22H22N6O2S/c1-14-18-21(26-17-5-3-2-4-10-27(17)22(18)30)31-19(14)20(29)24-11-15-6-8-16(9-7-15)28-13-23-12-25-28/h6-9,12-13H,2-5,10-11H2,1H3,(H,24,29) |
| InChIKey | KCOKCIFSBLUZMF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |