C17H17N5O8S — CID 55733147
5-nitro-1-[2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]pyridin-2-one (PubChem CID 55733147) has the molecular formula C17H17N5O8S and a molecular weight of 451.42 g/mol. Its IUPAC name is 5-nitro-1-[2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]pyridin-2-one.
| Compound Name | 5-nitro-1-[2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]pyridin-2-one |
|---|---|
| PubChem CID | 55733147 |
| Molecular Formula | C17H17N5O8S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 5-nitro-1-[2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]pyridin-2-one |
| SMILES | O=C(Cn1cc([N+](=O)[O-])ccc1=O)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H17N5O8S/c23-16-6-5-13(21(25)26)11-19(16)12-17(24)18-7-9-20(10-8-18)31(29,30)15-4-2-1-3-14(15)22(27)28/h1-6,11H,7-10,12H2 |
| InChIKey | ARVDJZGYASTWOJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 165.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|