C19H15Cl2N5O4 — CID 55733167
5-[4-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]piperazin-1-yl]-2-methyl-1,3-oxazole-4-carbonitrile (PubChem CID 55733167) has the molecular formula C19H15Cl2N5O4 and a molecular weight of 448.27 g/mol. Its IUPAC name is 5-[4-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]piperazin-1-yl]-2-methyl-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[4-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]piperazin-1-yl]-2-methyl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 55733167 |
| Molecular Formula | C19H15Cl2N5O4 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 5-[4-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]piperazin-1-yl]-2-methyl-1,3-oxazole-4-carbonitrile |
| SMILES | Cc1nc(C#N)c(N2CCN(C(=O)CN3C(=O)c4cc(Cl)c(Cl)cc4C3=O)CC2)o1 |
| InChI | InChI=1S/C19H15Cl2N5O4/c1-10-23-15(8-22)19(30-10)25-4-2-24(3-5-25)16(27)9-26-17(28)11-6-13(20)14(21)7-12(11)18(26)29/h6-7H,2-5,9H2,1H3 |
| InChIKey | WBZQYUFERLXXRZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|