C25H33N3O4 — CID 55734686
[2-(4-anilino-N-propan-2-ylanilino)-2-oxoethyl] 6-acetamidohexanoate (PubChem CID 55734686) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is [2-(4-anilino-N-propan-2-ylanilino)-2-oxoethyl] 6-acetamidohexanoate.
| Compound Name | [2-(4-anilino-N-propan-2-ylanilino)-2-oxoethyl] 6-acetamidohexanoate |
|---|---|
| PubChem CID | 55734686 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | [2-(4-anilino-N-propan-2-ylanilino)-2-oxoethyl] 6-acetamidohexanoate |
| SMILES | CC(=O)NCCCCCC(=O)OCC(=O)N(c1ccc(Nc2ccccc2)cc1)C(C)C |
| InChI | InChI=1S/C25H33N3O4/c1-19(2)28(23-15-13-22(14-16-23)27-21-10-6-4-7-11-21)24(30)18-32-25(31)12-8-5-9-17-26-20(3)29/h4,6-7,10-11,13-16,19,27H,5,8-9,12,17-18H2,1-3H3,(H,26,29) |
| InChIKey | JLDYHMZXQQSPCC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|