C23H22N6O4S — CID 55735218
N-(2,4-dimethylphenyl)-3-nitro-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylamino]benzenesulfonamide (PubChem CID 55735218) has the molecular formula C23H22N6O4S and a molecular weight of 478.53 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-nitro-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylamino]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-nitro-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 55735218 |
| Molecular Formula | C23H22N6O4S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-nitro-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylamino]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NCc3ccc(-n4cncn4)cc3)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C23H22N6O4S/c1-16-3-9-21(17(2)11-16)27-34(32,33)20-8-10-22(23(12-20)29(30)31)25-13-18-4-6-19(7-5-18)28-15-24-14-26-28/h3-12,14-15,25,27H,13H2,1-2H3 |
| InChIKey | BVDZXGKZGNJGJD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|