About 5-methyl-3,7-di(propan-2-yl)-4H-diazepine
5-methyl-3,7-di(propan-2-yl)-4H-diazepine (PubChem CID 557376) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 5-methyl-3,7-di(propan-2-yl)-4H-diazepine.
Molecular Properties
| Compound Name | 5-methyl-3,7-di(propan-2-yl)-4H-diazepine |
| PubChem CID | 557376 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 5-methyl-3,7-di(propan-2-yl)-4H-diazepine |
| SMILES | CC1=CC(C(C)C)=NN=C(C(C)C)C1 |
| InChI | InChI=1S/C12H20N2/c1-8(2)11-6-10(5)7-12(9(3)4)14-13-11/h6,8-9H,7H2,1-5H3 |
| InChIKey | JTBDDPJLSBXQJD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-3,7-di(propan-2-yl)-4H-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,7-di(propan-2-yl)-4H-diazepine?
The IUPAC name of 5-methyl-3,7-di(propan-2-yl)-4H-diazepine (CID 557376) is 5-methyl-3,7-di(propan-2-yl)-4H-diazepine.
What is the SMILES notation for 5-methyl-3,7-di(propan-2-yl)-4H-diazepine?
The canonical SMILES for 5-methyl-3,7-di(propan-2-yl)-4H-diazepine is CC1=CC(C(C)C)=NN=C(C(C)C)C1.
What is the InChIKey of 5-methyl-3,7-di(propan-2-yl)-4H-diazepine?
The InChIKey is JTBDDPJLSBXQJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-8(2)11-6-10(5)7-12(9(3)4)14-13-11/h6,8-9H,7H2,1-5H3.
What are the key properties of 5-methyl-3,7-di(propan-2-yl)-4H-diazepine?
5-methyl-3,7-di(propan-2-yl)-4H-diazepine has a molecular weight of 192.31 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,7-di(propan-2-yl)-4H-diazepine is sourced from PubChem (CID 557376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).