C20H23N5O4S — CID 55738184
4-(benzenesulfonyl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]piperazine-1-carboxamide (PubChem CID 55738184) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55738184 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCNC2=O)c1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N5O4S/c26-19-21-9-10-25(19)17-6-4-5-16(15-17)22-20(27)23-11-13-24(14-12-23)30(28,29)18-7-2-1-3-8-18/h1-8,15H,9-14H2,(H,21,26)(H,22,27) |
| InChIKey | RBZTYWYOEPPTFB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |