C11H3F4NO3 — CID 557384
6,7,8,9-tetrafluoro-3-methylchromeno[3,4-d][1,2]oxazol-4-one (PubChem CID 557384) has the molecular formula C11H3F4NO3 and a molecular weight of 273.14 g/mol. Its IUPAC name is 6,7,8,9-tetrafluoro-3-methylchromeno[3,4-d][1,2]oxazol-4-one.
| Compound Name | 6,7,8,9-tetrafluoro-3-methylchromeno[3,4-d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 557384 |
| Molecular Formula | C11H3F4NO3 |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 6,7,8,9-tetrafluoro-3-methylchromeno[3,4-d][1,2]oxazol-4-one |
| SMILES | Cc1noc2c1c(=O)oc1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C11H3F4NO3/c1-2-3-9(19-16-2)4-5(12)6(13)7(14)8(15)10(4)18-11(3)17/h1H3 |
| InChIKey | YTVAZUCTZGIHIG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|